Product name: | Aristolochic acid A |
Synonym: | Aristolochic acid; Isoaristolochic acid; Aristolochin; Aristinic acid; Aristolochia yellow; Descresept; Tardolyt |
Purity: | 98% + by HPLC |
Appearance: | |
Chemical Family: | Phenanthrenes |
Canonical SMILES: | COC1=CC=CC2=C3C(C(=CC4OCOC=43)C(O)=O)=C(C=C21)[N+]([O-])=O |
Botanical Source: | Alkaloid from a wide range of Aristolochia spp. Also found in the Chinese drug Fang-chi, Asarum canadense var. reflexum, Bragantia wallichii (preferred genus name Thottea), and in the butterflies Pachlioptera aristolochiae and Battus archidamas |