| Product name： | Scutellarein |
| Synonym： | 6-Hydroxyapigenin |
| Purity： | 98% + by HPLC |
| Appearance： | light brown |
| Chemical Family： | Flavonoids |
| Canonical SMILES： | OC1=C(O)C2C(=O)C=C(OC=2C=C1O)C1C=CC(O)=CC=1 |
| Botanical Source： | roots, stems and flowers of Scutellaria spp. Billbergia vittata, Pinguicula vulgaris, leaves of Clerodendrum phlomides and Clerodendrum serratum, from the aerial parts of Stachys inflata, and from various other plants |