| Product name： | Scopoletin |
| Synonym： | Chrysatropic acid; Gelseminic acid; β-Methylaesculetin; Buxuletin; Escopoletin; Scopoletol; Baogongteng B; Murrayetin |
| Purity： | 98% + by HPLC |
| Appearance： | White powder |
| Chemical Family： | Coumarins |
| Canonical SMILES： | COC1=CC2C=CC(=O)OC=2C=C1O |
| Botanical Source： | the root of Gelsemium sempervirens, Atropa belladonna, Convolvulus scammonia, Ipomoea orizabensis, Prunus serotina, Fabiana imbricata and also Diospyros spp., Peucedanum spp., Heracleum spp., Skimmia spp. |