| Product name： | Beta-Sitosterol |
| Synonym： | beta-Sitosterol; Nimbosterol; Cupreol; Quebrachol; Rhamnol; Cinchol; Verosterol; Slanutosterol; Raphanisterol; Papaveristerol; Sitosterol; Angelicin; 22,23-Dihydrostigmasterol |
| Purity： | 98% + by HPLC |
| Analysis Method： | |
| Identification Method： | |
| Appearance： | White powder |
| Chemical Family： | Terpenes |
| Canonical SMILES： | CCC(CCC(C)C1CCC2C1(CCC3C2CC=C4C3(CCC(C4)O)C)C)C(C)C |
| Botanical Source： | the commonest sterol of higher plants. Also occurs in marine organisms, incl. the scallop Placopecten magellanicus, the sponge Reniera sp. and the alga Cladophora densa |