Product name: | Beta-Sitosterol |
Synonym: | beta-Sitosterol; Nimbosterol; Cupreol; Quebrachol; Rhamnol; Cinchol; Verosterol; Slanutosterol; Raphanisterol; Papaveristerol; Sitosterol; Angelicin; 22,23-Dihydrostigmasterol |
Purity: | 98% + by HPLC |
Analysis Method: | |
Identification Method: | |
Appearance: | White powder |
Chemical Family: | Terpenes |
Canonical SMILES: | CCC(CCC(C)C1CCC2C1(CCC3C2CC=C4C3(CCC(C4)O)C)C)C(C)C |
Botanical Source: | the commonest sterol of higher plants. Also occurs in marine organisms, incl. the scallop Placopecten magellanicus, the sponge Reniera sp. and the alga Cladophora densa |