| Product name： | Quercetin |
| Synonym： | Sophoretin; Meletin; Quercetol; Quertin; Ericin |
| Purity： | 98% + by HPLC |
| Appearance： | Yellow powder |
| Chemical Family： | Flavonoids |
| Canonical SMILES： | C1=CC(=C(C=C1C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O)O)O |
| Botanical Source： | many plants, esp. fruits, such as Helichrysum, Euphorbia and Karwinskia spp. Present in the Solanaceae, Rhamnaceae, Passifloraceae and many other families. For example detected in almost all studied Umbelliferae |