Onjisaponin B

Product name: Onjisaponin B
Synonym: Senegin III; Sinegin 3
Purity: 98% + by HPLC
Analysis Method:
Identification Method:
Appearance: White powder
Chemical Family: Triterpenoids
Canonical SMILES: CC1C(C(C(C(O1)OC2C(C(OC(C2OC3C(C(C(C(O3)C)OC4C(C(C(CO4)OC5C(C(C(C(O5)CO)O)O)O)O)O)O)O)OC(=O)C67CCC(CC6C8=CCC9C(C8(CC7)CO)(CCC1C9(CC(C(C1(C)C(=O)O)OC1C(C(C(C(O1)CO)O)O)O)O)C)C)(C)C)C)OC(=O)C=CC1=CC=C(C=C1)OC)O)O)O
Botanical Source: Polygala senega and Polygala tenuifolia

Onjisaponin B Related Video: