| Product name： | Aristolochic acid A |
| Synonym： | Aristolochic acid; Isoaristolochic acid; Aristolochin; Aristinic acid; Aristolochia yellow; Descresept; Tardolyt |
| Purity： | 98% + by HPLC |
| Analysis Method： | |
| Identification Method： | |
| Appearance： | |
| Chemical Family： | Phenanthrenes |
| Canonical SMILES： | COC1=CC=CC2=C3C(C(=CC4OCOC=43)C(O)=O)=C(C=C21)[N+]([O-])=O |
| Botanical Source： | Alkaloid from a wide range of Aristolochia spp. Also found in the Chinese drug Fang-chi, Asarum canadense var. reflexum, Bragantia wallichii (preferred genus name Thottea), and in the butterflies Pachlioptera aristolochiae and Battus archidamas |