Product name: | Hyperoside |
Synonym: | Quercetin 3-galactoside; Hyperin |
Purity: | 98% + by HPLC |
Appearance: | Yellow powder |
Chemical Family: | Flavonoids |
Canonical SMILES: | OC[C@@H]1O[C@H](OC2C(=O)C3=C(C=C(O)C=C3O)OC=2C2=CC(O)=C(O)C=C2)[C@@H](O)[C@H](O)[C@@H]1O |
Botanical Source: | Occurs widely in plants, e.g. in apple peel, quince peel, Crataegus laevigata (hawthorn), Hypericum perforatum (St John's wort), Betula, Juglans and many other spp. Present in almost all of 60 investigated spp. in the Polygonaceae (Hnsel et al, 1954) |