| Product name： | Hyoscine |
| Synonym： | Scopolamine; Transcop; Transderm-Scop; Tropic acid ester with scopine; l-Scopolamine |
| Purity： | 98% + by HPLC |
| Appearance： | Oil |
| Chemical Family： | Alkaloids |
| Canonical SMILES： | CN1C2CC(CC1C1OC12)OC(=O)C(CO)C1C=CC=CC=1 |
| Botanical Source： | Alkaloid from Atropa, Datura, Hyoscyamus and Scopolia spp. and several other genera in the Solanaceae. Coml. sources are Datura metel, Datura meteloides and Datura fastuosa var alba |