Product name: | Juglone |
Synonym: | 5-Hydroxy-1,4-naphthoquinone |
Purity: | 98% + by HPLC |
Analysis Method: | |
Identification Method: | |
Appearance: | |
Chemical Family: | |
Canonical SMILES: | OC1=CC=CC2=C1C(=O)C=CC2=O |
Botanical Source: | Occurs in Juglans spp.; leaves and nuts of pecan (Carya illinoensis), leaves of Pterocarya fraxinifolia, Lomatia spp. and Platycarya strobilacea. Also prod. by Penicillium diversum var. aureum and a mutant of Verticillium dahliae |