Product name: | Hesperidin |
Synonym: | Citrus-hesperidin; Cirontin; Vitamin B; Cirantin; Hesperidoside; Hesperetin 7-rutinoside; Atripliside B |
Purity: | 98% + by HPLC |
Appearance: | Off-white powder |
Chemical Family: | Flavonoids |
Canonical SMILES: | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=CC(=C4C(=O)CC(OC4=C3)C5=CC(=C(C=C5)OC)O)O)O)O)O)O)O)O |
Botanical Source: | Found in most citrus fruits and other members of the Rutaceae, also in Mentha longifolia, Vernonia, Anthurium, Xanthoxylum spp. and many others. First oranges in 1828 |