Glucoraphanin
Product Detail
| | |
| Product name： | Glucoraphanin |
| Synonym： | 4-(Methylsulfinyl)butyl glucosinolate |
| Purity： | 98% + by HPLC |
| Analysis Method： | |
| Identification Method： | |
| Appearance： | Pale yellow powder |
| Chemical Family： | Miscellaneous |
| Canonical SMILES： | CS(=O)CCCC/C(=NOS(O)(=O)=O)/S[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| Botanical Source： | radish (Raphanus sativus) and Brassica sp. seeds or tops. Also isol. as the L-proline salt from the flowering heads of Cardaria draba (preferred genus name Lepidium) |
Product Tags
Glucoraphanin Related Video: