| Product name： | Cucurbitacin B |
| Synonym： | Amarin |
| Purity： | 98% + by HPLC |
| Appearance： | White powder |
| Chemical Family： | Triterpenoids |
| Canonical SMILES： | CC(=O)OC(C)(C)/C=C/C(=O)[C@@](C)(O)[C@@H]1[C@@H](O)C[C@]2(C)[C@H]3CC=C4[C@H](C[C@@H](O)C(=O)C4(C)C)[C@@]3(C)C(=O)C[C@]21C |
| Botanical Source： | Bitter principle of fruits of Cucurbitaceae, also present in some other plants, e.g. Anagallis arvensis, Luffa acutangula, Luffa graveolens, Luffa echinata, Echinocystis fabacea, Iberis spp., Begonia tuberhybris-alba, Begonia heracleifolia, Bryonia alba, |