| Product name： | cis-resveratrol |
| Synonym： | |
| Purity： | 98% + by HPLC |
| Appearance： | White crystalline powder |
| Chemical Family： | Phenols |
| Canonical SMILES： | C1=CC(=CC=C1C=CC2=CC(=CC(=C2)O)O)O |
| Botanical Source： | Phytoalexin from Veratrum grandiflorum (roots), Pinus sibirica (bark), Vitis vinifera and Arachis hypogaea. Also from Polygonum and Nothofagus spp., Cudrania javanensis, Eucalyptus spp. and other plants in the Leguminosae, Liliaceae, Myrtaceae, Gramineae |