Product name: | Chelidonine |
Synonym: | Stylophorine |
Purity: | 98% + by HPLC |
Analysis Method: | |
Identification Method: | |
Appearance: | white powder |
Chemical Family: | Alkaloids |
Canonical SMILES: | CN1CC2C3OCOC=3C=CC=2[C@@H]2[C@H](O)CC3C=C4OCOC4=CC=3[C@H]12 |
Botanical Source: | Alkaloid from Root of Chelidonium majus and Stylophorum diphyllum, and the aerial parts of Glaucium fimbrilligerum. Chelidonine (with no stereochemical designation) has also been Symphoricarpos albus, Dicranostigma franchetianum, Dicentra |