| Product name： | Daidzein |
| Synonym： | 4',7-Dihydroxyisoflavone ; Dimethylbiochanin B; Daizeol; K 251-6; Daidzeol; Tatoin; Isoaurostatin |
| Purity： | 98% + by HPLC |
| Analysis Method： | |
| Identification Method： | |
| Appearance： | White powder |
| Chemical Family： | Isoflavones |
| Canonical SMILES： | C1=CC(=CC=C1C2=COC3=C(C2=O)C=CC(=C3)O)O |
| Botanical Source： | Widespread isoflavone in the Leguminosae (Papilionoideae) e.g. in Chamaecytisus spp., Cytisus spp., Phaseolus spp. Also from Streptomyces xanthophaeus and Streptoverticillium album |