Product name: | Monotropein |
Synonym: | |
Purity: | 98% + by HPLC |
Analysis Method: | |
Identification Method: | |
Appearance: | Off-white powder |
Chemical Family: | Iridoids |
Canonical SMILES: | OC(=O)C1=CO[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H]2[C@@H]1C=C[C@]2(O)CO |
Botanical Source: | Monotropa hypopithys, Monotropa uniflora, Liquidambar styraciflua (sweet gum), Liquidambar orientalis (oriental sweet gum) and Pyrola renifolia. Widespread in the Pyrolaceae. Present in fruits of cranberry and other Vaccinium spp. |