| Product name： | Monotropein |
| Synonym： | |
| Purity： | 98% + by HPLC |
| Analysis Method： | |
| Identification Method： | |
| Appearance： | Off-white powder |
| Chemical Family： | Iridoids |
| Canonical SMILES： | OC(=O)C1=CO[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H]2[C@@H]1C=C[C@]2(O)CO |
| Botanical Source： | Monotropa hypopithys, Monotropa uniflora, Liquidambar styraciflua (sweet gum), Liquidambar orientalis (oriental sweet gum) and Pyrola renifolia. Widespread in the Pyrolaceae. Present in fruits of cranberry and other Vaccinium spp. |