| Product name： | Berberrubine |
| Synonym： | Chileninone |
| Purity： | 98% + by HPLC |
| Analysis Method： | |
| Identification Method： | |
| Appearance： | Red needle crystal |
| Chemical Family： | Alkaloids |
| Canonical SMILES： | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)O.[Cl-] |
| Botanical Source： | Alkaloid from the twigs of Berberis actinacantha and from the stems of Berberis darwinii and Berberis valdiviana. Also from Berberis vulgaris, Thalictrum polygamum and Fibraurea chloroleuca (Berberidaceae, Ranunculaceae, Menispermaceae) |