Product name: | Berberrubine |
Synonym: | Chileninone |
Purity: | 98% + by HPLC |
Analysis Method: | |
Identification Method: | |
Appearance: | Red needle crystal |
Chemical Family: | Alkaloids |
Canonical SMILES: | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)O.[Cl-] |
Botanical Source: | Alkaloid from the twigs of Berberis actinacantha and from the stems of Berberis darwinii and Berberis valdiviana. Also from Berberis vulgaris, Thalictrum polygamum and Fibraurea chloroleuca (Berberidaceae, Ranunculaceae, Menispermaceae) |