| | |
| Product name： | 1,8-Dihydroxyanthraquinone |
| Synonym： | Chrysazin; Dantron; Danthron, BAN; Istizin; Danivac; Dorbane |
| Purity： | 98% + by HPLC |
| Analysis Method： | |
| Identification Method： | |
| Appearance： | orange powder |
| Chemical Family： | Anthraquinones |
| Canonical SMILES： | OC1C=CC=C2C=1C(=O)C1=C(C=CC=C1O)C2=O |
| Botanical Source： | Occurs in roots of Rheum palmatum (Turkey rhubarb), leaves and stems of Xyris semifuscata, tissue culture of Cinchona ledgeriana and leaves of Pyrrhalta luteola. Watersipora subtorquata. Prod. by Actinoplanes louijashanensis C983 and Phomo |