16α-Hydroxytrametenolic acid

Product name: 16α-Hydroxytrametenolic acid
Synonym:
Purity: 98% + by HPLC
Analysis Method:
Identification Method:
Appearance:
Chemical Family: Triterpenoids
Canonical SMILES: CC(=CCCC(C1C(CC2(C1(CCC3=C2CCC4C3(CCC(C4(C)C)O)C)C)C)O)C(=O)O)C
Botanical Source: